CAS 1216430-61-3 appears in our catalog under these names: 1-Methyl Xanthine-d3, 1-Methylxanthine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1-(trideuteriomethyl)-3,7-dihydropurine-2,6-dione (CAS 1216430-61-3) is a chemical compound with the molecular formula C6H6N4O2 and a molecular weight of 169.16 g/mol. IUPAC name: 1-(trideuteriomethyl)-3,7-dihydropurine-2,6-dione. InChIKey: MVOYJPOZRLFTCP-FIBGUPNXSA-N.
| Molecular formula | C6H6N4O2 |
|---|---|
| Molecular weight | 169.16 g/mol |
| IUPAC name | 1-(trideuteriomethyl)-3,7-dihydropurine-2,6-dione |
| InChIKey | MVOYJPOZRLFTCP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)C2=C(NC1=O)N=CN2 |
Computed by PubChem (NCBI)