CAS 1216604-60-2 appears in our catalog under these names: 2-(3-Chlorophenyl)pyrimidine-4-carboxylic acid, 97%, 2-(3-Chlorophenyl)pyrimidine-4-carboxylic Acid, >95% (HPLC), 2-(3-Chlorophenyl)pyrimidine-4-carboxylic acid, 97%, 97%. Offered by: Fluorochem, TRC, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.
2-(3-chlorophenyl)pyrimidine-4-carboxylic acid (CAS 1216604-60-2) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 2-(3-chlorophenyl)pyrimidine-4-carboxylic acid. InChIKey: JYYUZXXZLABMHW-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 2-(3-chlorophenyl)pyrimidine-4-carboxylic acid |
| InChIKey | JYYUZXXZLABMHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)