CAS 1216704-96-9 is the registry number for Harmine-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
Harmine-d3 is a deuterated compound that is harmine in which all three hydrogen atoms of the methoxy group are replaced by deuterium. It is functionally related to a harmine.
Source: ChEBI
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 215.26 g/mol |
| IUPAC name | 1-methyl-7-(trideuteriomethoxy)-9H-pyrido[3,4-b]indole |
| InChIKey | BXNJHAXVSOCGBA-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C3=C(N2)C(=NC=C3)C |
Computed by PubChem (NCBI)