Products 1216885-36-7
CAS 1216885-36-7 appears in our catalog under these names: Fmoc-methylalanine-d3, Fmoc-Aib-OH-d3. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 1mg, 5mg.
3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (CAS 1216885-36-7) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 328.4 g/mol. IUPAC name: 3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid. InChIKey: HOZZVEPRYYCBTO-FIBGUPNXSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| InChIKey | HOZZVEPRYYCBTO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C)(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)