Products 1216916-40-3
CAS 1216916-40-3 appears in our catalog under these names: Benzyl-d7 Paraben, >95% (HPLC), Benzyl Paraben-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 4-hydroxybenzoate (CAS 1216916-40-3) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 235.29 g/mol. IUPAC name: [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 4-hydroxybenzoate. InChIKey: MOZDKDIOPSPTBH-DMCBOUTMSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 235.29 g/mol |
| IUPAC name | [dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl] 4-hydroxybenzoate |
| InChIKey | MOZDKDIOPSPTBH-DMCBOUTMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])OC(=O)C2=CC=C(C=C2)O)[2H])[2H] |
Computed by PubChem (NCBI)