Products 1217180-38-5
CAS 1217180-38-5 appears in our catalog under these names: rac Benzodioxole-5-butanamine-d3 Hydrochloride, rac Benzodioxole–5–butanamine–d3 Ηydrochloride. Offered by: TRC, GLPBio. Available pack sizes: 50mg.
1-(1,3-benzodioxol-5-yl)-4,4,4-trideuteriobutan-2-amine;hydrochloride (CAS 1217180-38-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 232.72 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-4,4,4-trideuteriobutan-2-amine;hydrochloride. InChIKey: LFRHMTZYADABJZ-NIIDSAIPSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 232.72 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-4,4,4-trideuteriobutan-2-amine;hydrochloride |
| InChIKey | LFRHMTZYADABJZ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])CC(CC1=CC2=C(C=C1)OCO2)N.Cl |
Computed by PubChem (NCBI)