Products 1217442-29-9
CAS 1217442-29-9 is the registry number for Fmoc-Ile-OH-13C6,15N, 99.90%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid (CAS 1217442-29-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 360.36 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid. InChIKey: QXVFEIPAZSXRGM-HJECYYBSSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 360.36 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | QXVFEIPAZSXRGM-HJECYYBSSA-N |
| SMILES | [13CH3][13CH2][13C@H]([13CH3])[13C@@H]([13C](=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)