CAS 251316-98-0 appears in our catalog under these names: (2S,3R)-2-(9H-Fluoren-9-ylmethoxycarboylamino)-3-methylpentanoic acid, 98%, 98%, Fmoc-Allo-Ile-OH, 98%, Fmoc-allo-ile-oh, Fmoc-L-allo-isoleucine, Fmoc–allo–Ile–OH. Offered by: Chemat, Ambeed, TRC, GLPBio, Iris Biotech. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid (CAS 251316-98-0) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid. InChIKey: QXVFEIPAZSXRGM-YJYMSZOUSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid |
| InChIKey | QXVFEIPAZSXRGM-YJYMSZOUSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)