Products 204633-89-6
CAS 204633-89-6 is the registry number for Fmoc-Ile-OH-15N, 95.14%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 100 mg, 10 mg, 50 mg.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-methylpentanoic acid (CAS 204633-89-6) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 354.4 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-methylpentanoic acid. InChIKey: QXVFEIPAZSXRGM-FYOZIULDSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-methylpentanoic acid |
| InChIKey | QXVFEIPAZSXRGM-FYOZIULDSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)