Products 1217530-86-3
CAS 1217530-86-3 appears in our catalog under these names: Methyl (3r)-3-amino-3-(4-chlorophenyl)propanoate hydrochloride, 95%, METHYL (R)-3-AMINO-3-(4-CHLOROPHENYL)PROPANOATE HCL, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Methyl (3R)-3-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 1217530-86-3) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl (3R)-3-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: CKHLTQXMMBPPQU-SBSPUUFOSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | CKHLTQXMMBPPQU-SBSPUUFOSA-N |
| SMILES | COC(=O)C[C@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)