Products 1171667-89-2

CAS 1171667-89-2 is the registry number for Methyl 3-amino-3-(2-chlorophenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-amino-3-(2-chlorophenyl)propanoate;hydrochloride (CAS 1171667-89-2) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl 3-amino-3-(2-chlorophenyl)propanoate;hydrochloride. InChIKey: LPBJVSCNUUOIGM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13Cl2NO2
Molecular weight250.12 g/mol
IUPAC namemethyl 3-amino-3-(2-chlorophenyl)propanoate;hydrochloride
InChIKeyLPBJVSCNUUOIGM-UHFFFAOYSA-N
SMILESCOC(=O)CC(C1=CC=CC=C1Cl)N.Cl

Computed by PubChem (NCBI)