CAS 331763-59-8 appears in our catalog under these names: (R)-3-Amino-4-(4-chloro-phenyl)-butyric acid hydrochloride, 95%, (R)-3-Amino-4-(4-chlorophenyl)butanoic acid hydrochloride, 98+%, (R)–3–Amino–4–(4–chlorophenyl)butanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3R)-3-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride (CAS 331763-59-8) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: (3R)-3-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride. InChIKey: PUVXCDYJZZWKMH-SBSPUUFOSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (3R)-3-amino-4-(4-chlorophenyl)butanoic acid;hydrochloride |
| InChIKey | PUVXCDYJZZWKMH-SBSPUUFOSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](CC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)