CAS 268734-28-7 is the registry number for (R)-3-Amino-4-(2-chlorophenyl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3R)-3-amino-4-(2-chlorophenyl)butanoic acid;hydrochloride (CAS 268734-28-7) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: (3R)-3-amino-4-(2-chlorophenyl)butanoic acid;hydrochloride. InChIKey: POAZZXSNVUMPBP-DDWIOCJRSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (3R)-3-amino-4-(2-chlorophenyl)butanoic acid;hydrochloride |
| InChIKey | POAZZXSNVUMPBP-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)