CAS 60594-65-2 appears in our catalog under these names: (S)-Methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, 95%, 4-Chloro-L-phenylalanine methyl ester hydrochloride, 95%, 95%, (S)-Methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
Methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 60594-65-2) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GCBCWTWQAFLKJG-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GCBCWTWQAFLKJG-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)