Products 1881290-47-6
CAS 1881290-47-6 is the registry number for propan-2-yl 3-amino-4-chlorobenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Propan-2-yl 3-amino-4-chlorobenzoate;hydrochloride (CAS 1881290-47-6) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: propan-2-yl 3-amino-4-chlorobenzoate;hydrochloride. InChIKey: WJZQXZAGIQDRFT-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | propan-2-yl 3-amino-4-chlorobenzoate;hydrochloride |
| InChIKey | WJZQXZAGIQDRFT-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)