CAS 1217696-23-5 is the registry number for (2S)-(3-Oxo-1,2-benzisothiazol-2(3h)-yl)(phenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid (CAS 1217696-23-5) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid. InChIKey: RLULBIWQZOAADG-ZDUSSCGKSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | (2S)-2-(3-oxo-1,2-benzothiazol-2-yl)-2-phenylacetic acid |
| InChIKey | RLULBIWQZOAADG-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)O)N2C(=O)C3=CC=CC=C3S2 |
Computed by PubChem (NCBI)