CAS 923743-86-6 is the registry number for 2-(2-(5-Methylthiophen-2-yl)-2-oxoethyl)isoindoline-1,3-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]isoindole-1,3-dione (CAS 923743-86-6) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: 2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]isoindole-1,3-dione. InChIKey: LKOQRELTOFWKFB-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 2-[2-(5-methylthiophen-2-yl)-2-oxoethyl]isoindole-1,3-dione |
| InChIKey | LKOQRELTOFWKFB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C(=O)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)