CAS 229641-87-6 is the registry number for Benzoic acid, 4-(2-benzothiazolylmethoxy)-, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid (CAS 229641-87-6) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid. InChIKey: OPUHKKHAAHFKFD-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-ylmethoxy)benzoic acid |
| InChIKey | OPUHKKHAAHFKFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)