CAS 915880-65-8 is the registry number for 3-[(1,3-Benzoxazol-2-ylthio)methyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid (CAS 915880-65-8) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: 3-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid. InChIKey: WOXNQRUDMFQBRT-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 3-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid |
| InChIKey | WOXNQRUDMFQBRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)SCC3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)