Products 2387596-20-3
CAS 2387596-20-3 is the registry number for 7-Methyl-5-oxo-3-phenyl-5H-thiazolo[3,2-a]pyridine-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid (CAS 2387596-20-3) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: 7-methyl-5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid. InChIKey: VCPIKCQVHPQKII-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 7-methyl-5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid |
| InChIKey | VCPIKCQVHPQKII-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=CSC2=C1C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)