Products 733795-46-5
CAS 733795-46-5 appears in our catalog under these names: 2-[(1,3-Benzoxazol-2-ylthio)methyl]benzoic acid, 95%, 2-((1,3-Benzoxazol-2-ylsulfanyl)methyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid (CAS 733795-46-5) is a chemical compound with the molecular formula C15H11NO3S and a molecular weight of 285.3 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid. InChIKey: UIUXINYILGLYBR-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3S |
|---|---|
| Molecular weight | 285.3 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-ylsulfanylmethyl)benzoic acid |
| InChIKey | UIUXINYILGLYBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CSC2=NC3=CC=CC=C3O2)C(=O)O |
Computed by PubChem (NCBI)