Products 121772-84-7
CAS 121772-84-7 appears in our catalog under these names: Methyl 3-bromo-2-iodobenzoate, 95%, Methyl 3-bromo-2-iodobenzoate, Methyl 3-bromo-2-iodobenzoate 97%, Benzoic acid, 3-bromo-2-iodo-, methyl ester, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2,5g, 100mg.
Methyl 3-bromo-2-iodobenzoate (CAS 121772-84-7) is a chemical compound with the molecular formula C8H6BrIO2 and a molecular weight of 340.94 g/mol. IUPAC name: methyl 3-bromo-2-iodobenzoate. InChIKey: UVSNHIBMLWUZCP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrIO2 |
|---|---|
| Molecular weight | 340.94 g/mol |
| IUPAC name | methyl 3-bromo-2-iodobenzoate |
| InChIKey | UVSNHIBMLWUZCP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)I |
Computed by PubChem (NCBI)