Products 324077-62-5
CAS 324077-62-5 appears in our catalog under these names: ZSET–845, Imidazo(1,2-a)pyridin-2(3H)-one, ZSET-845. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 20mg, 25mg, Get quote.
3,3-dibenzylimidazo[1,2-a]pyridin-2-one (CAS 324077-62-5) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: 3,3-dibenzylimidazo[1,2-a]pyridin-2-one. InChIKey: AGKKYNURMHHCFP-UHFFFAOYSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3,3-dibenzylimidazo[1,2-a]pyridin-2-one |
| InChIKey | AGKKYNURMHHCFP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2(C(=O)N=C3N2C=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)