CAS 2757082-55-4 appears in our catalog under these names: (R)-4-Benzyl-2-(6-phenylpyridin-2-yl)-4,5-dihydrooxazole 98% 99%ee, (R)-4-benzyl-2-(6-phenylpyridin-2-yl)-4,5-dihydrooxazole, 98% 99%ee, 98% 99%ee, (R)-4-Benzyl-2-(6-phenylpyridin-2-yl)-4,5-dihydrooxazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(4R)-4-benzyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2757082-55-4) is a chemical compound with the molecular formula C21H18N2O and a molecular weight of 314.4 g/mol. IUPAC name: (4R)-4-benzyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: GIBSLBRVBBSKFV-GOSISDBHSA-N.
| Molecular formula | C21H18N2O |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | (4R)-4-benzyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | GIBSLBRVBBSKFV-GOSISDBHSA-N |
| SMILES | C1[C@H](N=C(O1)C2=CC=CC(=N2)C3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)