Products 1217838-71-5
CAS 1217838-71-5 appears in our catalog under these names: Biopterin-d3, >95% (HPLC), 6-Biopterin-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 500 μg, 5 mg, 1 mg.
2-amino-6-[(1R,2S)-3,3,3-trideuterio-1,2-dihydroxypropyl]-3H-pteridin-4-one (CAS 1217838-71-5) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 240.23 g/mol. IUPAC name: 2-amino-6-[(1R,2S)-3,3,3-trideuterio-1,2-dihydroxypropyl]-3H-pteridin-4-one. InChIKey: LHQIJBMDNUYRAM-OERXLRDQSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | 2-amino-6-[(1R,2S)-3,3,3-trideuterio-1,2-dihydroxypropyl]-3H-pteridin-4-one |
| InChIKey | LHQIJBMDNUYRAM-OERXLRDQSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H]([C@@H](C1=CN=C2C(=N1)C(=O)NC(=N2)N)O)O |
Computed by PubChem (NCBI)