CAS 2636-52-4 appears in our catalog under these names: L-Primapterin, 97%, L-Primapterin, 7-Biopterin, 7–Biopterin. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 500μg, 5 mg, 1 mg.
2-amino-7-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one (CAS 2636-52-4) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. IUPAC name: 2-amino-7-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one. InChIKey: LNXRKRFGNHXANN-DZSWIPIPSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 2-amino-7-[(1R,2S)-1,2-dihydroxypropyl]-3H-pteridin-4-one |
| InChIKey | LNXRKRFGNHXANN-DZSWIPIPSA-N |
| SMILES | C[C@@H]([C@@H](C1=CN=C2C(=O)NC(=NC2=N1)N)O)O |
Computed by PubChem (NCBI)