Products 2089333-13-9
CAS 2089333-13-9 is the registry number for 4-(6-Nitro-3-pyridinyl)-1-nitroso-piperazine-2,2,6,6-d4. Offered by: TRC. Available pack sizes: 500mg.
2,2,6,6-tetradeuterio-4-(6-nitro-3-pyridinyl)-1-nitrosopiperazine (CAS 2089333-13-9) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 241.24 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-4-(6-nitro-3-pyridinyl)-1-nitrosopiperazine. InChIKey: GZWQRTKBTWTPLK-NZLXMSDQSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-4-(6-nitro-3-pyridinyl)-1-nitrosopiperazine |
| InChIKey | GZWQRTKBTWTPLK-NZLXMSDQSA-N |
| SMILES | [2H]C1(CN(CC(N1N=O)([2H])[2H])C2=CN=C(C=C2)[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)