Products 2089333-12-8
CAS 2089333-12-8 appears in our catalog under these names: N-Nitroso Palbociclib Impurity 35, 4-(6-Nitro-3-pyridinyl)-1-nitroso-piperazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
1-(6-nitro-3-pyridinyl)-4-nitrosopiperazine (CAS 2089333-12-8) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. IUPAC name: 1-(6-nitro-3-pyridinyl)-4-nitrosopiperazine. InChIKey: GZWQRTKBTWTPLK-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 1-(6-nitro-3-pyridinyl)-4-nitrosopiperazine |
| InChIKey | GZWQRTKBTWTPLK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CN=C(C=C2)[N+](=O)[O-])N=O |
Computed by PubChem (NCBI)