Products 13019-52-8
CAS 13019-52-8 appears in our catalog under these names: D–threo–Biopterin, D-threo-Biopterin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1 mg, 10 mg, 25 mg, 5 mg.
2-amino-6-[(1R,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one (CAS 13019-52-8) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. IUPAC name: 2-amino-6-[(1R,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one. InChIKey: LHQIJBMDNUYRAM-CVYQJGLWSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 2-amino-6-[(1R,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one |
| InChIKey | LHQIJBMDNUYRAM-CVYQJGLWSA-N |
| SMILES | C[C@H]([C@@H](C1=CN=C2C(=N1)C(=O)NC(=N2)N)O)O |
Computed by PubChem (NCBI)