CAS 13019-53-9 is the registry number for Anapterin. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 250mg, 100mg.
2-amino-7-[(1S,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one (CAS 13019-53-9) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. IUPAC name: 2-amino-7-[(1S,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one. InChIKey: LNXRKRFGNHXANN-AWFVSMACSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 2-amino-7-[(1S,2R)-1,2-dihydroxypropyl]-3H-pteridin-4-one |
| InChIKey | LNXRKRFGNHXANN-AWFVSMACSA-N |
| SMILES | C[C@H]([C@H](C1=CN=C2C(=O)NC(=NC2=N1)N)O)O |
Computed by PubChem (NCBI)