Products 59225-09-1
CAS 59225-09-1 is the registry number for 4-(Methoxymethyl)-6-methyl-5-nitro-1H-pyrazolo[3,4-b]pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(methoxymethyl)-6-methyl-5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 59225-09-1) is a chemical compound with the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. IUPAC name: 4-(methoxymethyl)-6-methyl-5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: PTYNTPJRMYLKLZ-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O3 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 4-(methoxymethyl)-6-methyl-5-nitro-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | PTYNTPJRMYLKLZ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NNC(=C2C(=C1[N+](=O)[O-])COC)N |
Computed by PubChem (NCBI)