Products 1218810-53-7
CAS 1218810-53-7 is the registry number for Ethyl (2E)-4-aminobut-2-enoate, trifluoroacetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid (CAS 1218810-53-7) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: ethyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid. InChIKey: PBCUXVBAFHEINJ-BJILWQEISA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | ethyl (E)-4-aminobut-2-enoate;2,2,2-trifluoroacetic acid |
| InChIKey | PBCUXVBAFHEINJ-BJILWQEISA-N |
| SMILES | CCOC(=O)/C=C/CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)