Products 1219147-84-8
CAS 1219147-84-8 is the registry number for 2,4:3,5-Di-O-benzylidene-L-idaric acid. Offered by: Biosynth. Available pack sizes: 10mg, 5mg.
2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4,8-dicarboxylic acid (CAS 1219147-84-8) is a chemical compound with the molecular formula C20H18O8 and a molecular weight of 386.4 g/mol. IUPAC name: 2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4,8-dicarboxylic acid. InChIKey: SAXMJKQNXWJEFL-UHFFFAOYSA-N.
| Molecular formula | C20H18O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 2,6-diphenyl-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxine-4,8-dicarboxylic acid |
| InChIKey | SAXMJKQNXWJEFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2OC3C(C(O2)C(=O)O)OC(OC3C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)