CAS 1219198-88-5 appears in our catalog under these names: Methyl amino(3-bromophenyl)acetate hydrochloride, 95%, Methyl 2-amino-2-(3-bromophenyl)acetate hydrochloride, 95%, Methyl amino(3–bromophenyl)acetate hydrochloride, Methyl Amino(3-bromophenyl)acetate Hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg, 0,5g.
Methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride (CAS 1219198-88-5) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride. InChIKey: UYQXPUQVLSXOMR-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 2-amino-2-(3-bromophenyl)acetate;hydrochloride |
| InChIKey | UYQXPUQVLSXOMR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)