Products 1280786-55-1
CAS 1280786-55-1 is the registry number for 2-Bromo-5-(dimethylamino)benzoic acid hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-5-(dimethylamino)benzoic acid;hydrochloride (CAS 1280786-55-1) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: 2-bromo-5-(dimethylamino)benzoic acid;hydrochloride. InChIKey: IMMCFMLZTZKEEX-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | 2-bromo-5-(dimethylamino)benzoic acid;hydrochloride |
| InChIKey | IMMCFMLZTZKEEX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)Br)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-Bromo-5-(dimethylamino)benzoic acid hydrochloride, 2-Bromo-5-(dimethylamino)benzoic acid, HCl, 2-bromo-5-(dimethylamino)benzoic acid;hydrochloride, 2-Bromo-5-(dimethylamino)benzoic acidhydrochloride, 2-Bromo-5-(dimethylamino)benzoic acid HCl, 2-Bromo-5-(dimethylamino)benzoicacidhydrochloride, 2-Bromo-5-(dimethylamino)benzoic acid--hydrogen chloride (1/1)