CAS 1391457-11-6 appears in our catalog under these names: (S)-Methyl 2-amino-2-(3-bromophenyl)acetate hydrochloride, 95%, Methyl (2S)-2-amino-2-(3-bromophenyl)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
Methyl (2S)-2-amino-2-(3-bromophenyl)acetate;hydrochloride (CAS 1391457-11-6) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl (2S)-2-amino-2-(3-bromophenyl)acetate;hydrochloride. InChIKey: UYQXPUQVLSXOMR-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(3-bromophenyl)acetate;hydrochloride |
| InChIKey | UYQXPUQVLSXOMR-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)