Products 128834-01-5
CAS 128834-01-5 appears in our catalog under these names: 2-amino-3-(2-bromophenyl)propanoic acid hydrochloride, 95%, 2-Amino-3-(2-bromophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g.
2-amino-3-(2-bromophenyl)propanoic acid;hydrochloride (CAS 128834-01-5) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: 2-amino-3-(2-bromophenyl)propanoic acid;hydrochloride. InChIKey: BJVZGHXWILEJDD-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | 2-amino-3-(2-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | BJVZGHXWILEJDD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)