CAS 930769-56-5 appears in our catalog under these names: (3S)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, 95%, (S)–3–Amino–3–(4–bromophenyl)propanoic acid hydrochloride, Benzenepropanoic acid, β-amino-4-bromo-, hydrochloride (1:1), (βS)-, 95%, 95%, (S)-3-Amino-3-(4-bromophenyl)propanoic acid HCl, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
(3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 930769-56-5) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: UDMBAXSJPLSJGM-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | UDMBAXSJPLSJGM-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)