CAS 499794-78-4 appears in our catalog under these names: (R)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, 95%, (R)–3–Amino–3–(4–bromophenyl)propanoic acid hydrochloride, (3R)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, (R)-3-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 499794-78-4) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (3R)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: UDMBAXSJPLSJGM-DDWIOCJRSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | UDMBAXSJPLSJGM-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)