Products 108540-72-3

CAS 108540-72-3 is the registry number for 2-Amino-3-(4-bromophenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 50g.

Structural formula: {0} (CAS {1})

2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 108540-72-3) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: 2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: GRWMPXZZFAPLFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BrClNO2
Molecular weight280.54 g/mol
IUPAC name2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride
InChIKeyGRWMPXZZFAPLFZ-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(C(=O)O)N)Br.Cl

Computed by PubChem (NCBI)