Products 1219795-57-9
CAS 1219795-57-9 is the registry number for Methyl 2-amino-3,6-dibromobenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-3,6-dibromobenzoate (CAS 1219795-57-9) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: methyl 2-amino-3,6-dibromobenzoate. InChIKey: GHEZQQJVBNVTEY-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | methyl 2-amino-3,6-dibromobenzoate |
| InChIKey | GHEZQQJVBNVTEY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1N)Br)Br |
Computed by PubChem (NCBI)