CAS 1219798-54-5 appears in our catalog under these names: 2-Hydroxy-4-methoxybenzophenone-2',3',4',5',6'-d5, >95% (HPLC), 2-Hydroxy-4-methoxybenzophenone-2',3',4',5',6'-d5, 99 atom % D, min 98% Chemical Purity, Oxybenzone-(phenyl-d5), D5-Oxybenzone, Oxybenzone-d5, 99%. Offered by: TRC, CDN, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 50mg, 5mg, 0,5g, 0,25g, 100mg, 1x10mg, 1 mg.
(2-hydroxy-4-methoxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 1219798-54-5) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 233.27 g/mol. IUPAC name: (2-hydroxy-4-methoxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: DXGLGDHPHMLXJC-VIQYUKPQSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | (2-hydroxy-4-methoxyphenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | DXGLGDHPHMLXJC-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C=C(C=C2)OC)O)[2H])[2H] |
Computed by PubChem (NCBI)