CAS 1219802-40-0 appears in our catalog under these names: Benzyl Salicylate-d4, Benzyl 2-Hydroxybenzoate-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, Benzyl salicylate–d4, Benzyl salicylate-d4, 99.01%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 25mg, 0,1g, 0,05g, 5mg, 10 mg, 1 mg.
Benzyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate (CAS 1219802-40-0) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 232.27 g/mol. IUPAC name: benzyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate. InChIKey: ZCTQGTTXIYCGGC-DOGSKSIHSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | benzyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate |
| InChIKey | ZCTQGTTXIYCGGC-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC2=CC=CC=C2)O)[2H])[2H] |
Computed by PubChem (NCBI)