Products 1219804-69-9

CAS 1219804-69-9 is the registry number for 4,6-Dinitro-2-methyl-d3-phenol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.

Structural formula: {0} (CAS {1})

2,4-dinitro-6-(trideuteriomethyl)phenol (CAS 1219804-69-9) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 201.15 g/mol. IUPAC name: 2,4-dinitro-6-(trideuteriomethyl)phenol. InChIKey: ZXVONLUNISGICL-FIBGUPNXSA-N.

Identity
Molecular formulaC7H6N2O5
Molecular weight201.15 g/mol
IUPAC name2,4-dinitro-6-(trideuteriomethyl)phenol
InChIKeyZXVONLUNISGICL-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])C1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-]

Computed by PubChem (NCBI)