CAS 1219804-69-9 is the registry number for 4,6-Dinitro-2-methyl-d3-phenol, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g, 0,05g.
2,4-dinitro-6-(trideuteriomethyl)phenol (CAS 1219804-69-9) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 201.15 g/mol. IUPAC name: 2,4-dinitro-6-(trideuteriomethyl)phenol. InChIKey: ZXVONLUNISGICL-FIBGUPNXSA-N.
| Molecular formula | C7H6N2O5 |
|---|---|
| Molecular weight | 201.15 g/mol |
| IUPAC name | 2,4-dinitro-6-(trideuteriomethyl)phenol |
| InChIKey | ZXVONLUNISGICL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC(=CC(=C1O)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)