Products 2733269-65-1

CAS 2733269-65-1 is the registry number for DNOC D5 (ring D2, methyl D3) 100 µg/mL in Acetone. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

3,5-dideuterio-2,4-dinitro-6-(trideuteriomethyl)phenol (CAS 2733269-65-1) is a chemical compound with the molecular formula C7H6N2O5 and a molecular weight of 203.16 g/mol. IUPAC name: 3,5-dideuterio-2,4-dinitro-6-(trideuteriomethyl)phenol. InChIKey: ZXVONLUNISGICL-RHIBPKLGSA-N.

Identity
Molecular formulaC7H6N2O5
Molecular weight203.16 g/mol
IUPAC name3,5-dideuterio-2,4-dinitro-6-(trideuteriomethyl)phenol
InChIKeyZXVONLUNISGICL-RHIBPKLGSA-N
SMILES[2H]C1=C(C(=C(C(=C1[N+](=O)[O-])[2H])[N+](=O)[O-])O)C([2H])([2H])[2H]

Computed by PubChem (NCBI)