Products 1220993-48-5
CAS 1220993-48-5 is the registry number for (7R)-3,4-Dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(7R)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid (CAS 1220993-48-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (7R)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid. InChIKey: IHPWCJZOCLQJPX-MRVPVSSYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (7R)-3,4-dimethoxybicyclo[4.2.0]octa-1,3,5-triene-7-carboxylic acid |
| InChIKey | IHPWCJZOCLQJPX-MRVPVSSYSA-N |
| SMILES | COC1=C(C=C2[C@@H](CC2=C1)C(=O)O)OC |
Computed by PubChem (NCBI)