CAS 1221160-70-8 appears in our catalog under these names: Ramelteon Impurity M, Ramelteon Impurity 35. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one (CAS 1221160-70-8) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 5-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one. InChIKey: WBYZCPYZHMZPHD-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 5-bromo-1,2,6,7-tetrahydrocyclopenta[e][1]benzofuran-8-one |
| InChIKey | WBYZCPYZHMZPHD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C3CCOC3=CC(=C21)Br |
Computed by PubChem (NCBI)