CAS 1801853-67-7 appears in our catalog under these names: 1-(2-Bromo-5-methoxyphenyl)buta-2,3-dien-1-one, 98%, 1-(2-Bromo-5-methoxyphenyl)-2,3-butadien-1-one, 98%, 98%, 1-(2-Bromo-5-methoxyphenyl)-2,3-butadien-1-one, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
1-(2-bromo-5-methoxyphenyl)buta-2,3-dien-1-one (CAS 1801853-67-7) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 1-(2-bromo-5-methoxyphenyl)buta-2,3-dien-1-one. InChIKey: NLRKJMFYZPANTO-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 1-(2-bromo-5-methoxyphenyl)buta-2,3-dien-1-one |
| InChIKey | NLRKJMFYZPANTO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)C=C=C |
Computed by PubChem (NCBI)