CAS 2060034-66-2 appears in our catalog under these names: 5-Bromo-1H,1aH,6H,6aH-cyclopropa(a)indene-1-carboxylic acid, 95%, 5-Bromo-1H,1aH,6H,6aH-cyclopropa(A)indene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid (CAS 2060034-66-2) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 5-bromo-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid. InChIKey: GPDGZULMFPEJED-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 5-bromo-1,1a,6,6a-tetrahydrocyclopropa[a]indene-1-carboxylic acid |
| InChIKey | GPDGZULMFPEJED-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C(=O)O)C3=C1C(=CC=C3)Br |
Computed by PubChem (NCBI)