Products 137206-73-6
CAS 137206-73-6 appears in our catalog under these names: 5-Bromo-7-ethylbenzofuran-2-carbaldehyde, 97%, 5-Bromo-7-ethyl-2-formyl-benzofuran. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
5-bromo-7-ethyl-1-benzofuran-2-carbaldehyde (CAS 137206-73-6) is a chemical compound with the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. IUPAC name: 5-bromo-7-ethyl-1-benzofuran-2-carbaldehyde. InChIKey: QWORBQILFUGMSQ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO2 |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 5-bromo-7-ethyl-1-benzofuran-2-carbaldehyde |
| InChIKey | QWORBQILFUGMSQ-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC(=C1)Br)C=C(O2)C=O |
Computed by PubChem (NCBI)